CymitQuimica logo

CAS 139585-50-5

:

4-chloro-2-(trimethylsilyl)pyridine

Description:
4-Chloro-2-(trimethylsilyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 4-position and a trimethylsilyl group at the 2-position significantly influences its chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its role as a reagent in organic synthesis, particularly in reactions involving nucleophilic substitution and as a protecting group for alcohols and amines. The trimethylsilyl group enhances the compound's stability and solubility in organic solvents, making it useful in various chemical reactions. Additionally, 4-chloro-2-(trimethylsilyl)pyridine exhibits moderate toxicity and should be handled with care in a laboratory setting. Its reactivity and functional groups make it a valuable intermediate in the synthesis of more complex organic molecules.
Formula:C8H12ClNSi
InChI:InChI=1/C8H12ClNSi/c1-11(2,3)8-6-7(9)4-5-10-8/h4-6H,1-3H3
SMILES:C[Si](C)(C)c1cc(ccn1)Cl
Synonyms:
  • Pyridine, 4-chloro-2-(trimethylsilyl)-
Found 1 products.