CAS 139601-96-0
:enopeptin A
Description:
Enopeptin A is a cyclic peptide that belongs to a class of compounds known for their potential biological activities, particularly in the field of pharmaceuticals. It is derived from certain microbial sources, specifically from the fermentation of actinomycetes. The structure of enopeptin A features a unique cyclic arrangement of amino acids, which contributes to its stability and bioactivity. This compound has garnered interest due to its reported antimicrobial properties, making it a candidate for further research in drug development. Additionally, enopeptin A may exhibit various mechanisms of action, including inhibition of specific enzymes or interference with cellular processes in target organisms. Its relatively complex structure and the presence of non-standard amino acids can influence its pharmacokinetic properties, such as solubility and permeability. As research continues, enopeptin A may reveal more about its potential therapeutic applications and mechanisms of action, highlighting the importance of natural products in the discovery of new medicinal compounds.
Formula:C47H57N7O11
InChI:InChI=1/C47H57N7O11/c1-29-26-47(54(27-29)44(62)31(3)49-42(60)30(2)48-4)41(59)35-19-16-24-53(35)45(63)34(28-65-46(47)64)51-43(61)33(25-32-17-12-11-13-18-32)50-38(57)20-14-9-7-5-6-8-10-15-21-39(58)52-40-36(55)22-23-37(40)56/h5-15,17-18,20-21,29-31,33-35,48,55H,16,19,22-28H2,1-4H3,(H,49,60)(H,50,57)(H,51,61)(H,52,58)/b6-5+,9-7+,10-8+,20-14+,21-15+/t29-,30+,31+,33+,34+,35+,47?/m1/s1
Synonyms:- Brn 5373924
- (2E,4E,6E,8E,10E)-N-[(1S)-1-benzyl-2-{[(4R,6'S,11a'S)-4-methyl-1-(N-methyl-L-alanyl-L-alanyl)-1',3',7'-trioxohexahydro-1'H,5'H-spiro[pyrrolidine-2,2'-pyrrolo[1,2-e][1,5]oxazonin]-6'-yl]amino}-2-oxoethyl]-N'-(2-hydroxy-5-oxocyclopent-1-en-1-yl)dodeca-2,4,6,8,10-pentaenediamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Enopeptin A
CAS:Enopeptin A: depsipeptide antibiotic with unique amino acids, combats Gram-positive/negative bacteria, not antifungal.Formula:C47H57N7O11Color and Shape:SolidMolecular weight:896.011
