CAS 139628-16-3

(-)-((8,8-(dichloro camphoryl)sulfonyl)oxaziridine

Description:

The chemical substance known as (-)-((8,8-(dichloro camphoryl)sulfonyl)oxaziridine) is a chiral oxaziridine compound, characterized by its unique structural features that include a sulfonyl group and a dichlorocamphoryl moiety. This compound is notable for its potential applications in asymmetric synthesis, particularly in the formation of enantiomerically enriched products. The presence of the oxaziridine ring contributes to its reactivity, allowing it to participate in various chemical transformations, including oxidation reactions. The dichloro substituents enhance its electrophilic character, making it a useful reagent in organic synthesis. Additionally, the chiral nature of the camphoryl group imparts stereochemical control, which is valuable in the synthesis of pharmaceuticals and other fine chemicals. Overall, this compound exemplifies the intersection of chirality and reactivity, making it a significant entity in the field of synthetic organic chemistry.

Formula: C₁₀H₁₃Cl₂NO₃S

InChI: InChI=1/C10H13Cl2NO3S/c1-7(2)6-3-4-8(7)5-17(14,15)13-10(8,16-13)9(6,11)12/h6H,3-5H2,1-2H3/t6-,8-,10?,13?/m1/s1

SMILES: CC1(C)[C@H]2CC[C@]31CS(=O)(=O)N1C3(C2(Cl)Cl)O1

Synonyms:

• (-)-(8,8-Dichlorocamphorylsulfonyl)-oxaziridine

4H-4a,7-Methanooxazirino[3,2-i][2,1]benzisothiazole, 8,8-dichlorotetrahydro-9,9-dimethyl-, 3,3-dioxide, (4aR,7R,8aS)-

CAS: 139628-16-3

Formula: C₁₀H₁₃Cl₂NO₃S

Purity: 95%

Color and Shape: Solid

Molecular weight: 298.1861

Ref: IN-DA001BET

(4Ar,7R,8As)-8,8-Dichloro-9,9-Dimethyltetrahydro-4H-4A,7-Methanobenzo[C][1,2]Oxazireno[2,3-B]Isothiazole 3,3-Dioxide

CAS: 139628-16-3

(4Ar,7R,8As)-8,8-Dichloro-9,9-Dimethyltetrahydro-4H-4A,7-Methanobenzo[C][1,2]Oxazireno[2,3-B]Isothiazole 3,3-Dioxide

Purity: 98%

Molecular weight: 298.19g/mol

Ref: 54-OR1008158

(−)-(8,8-Dichlorocamphorylsulfonyl) oxaziridine

CAS: 139628-16-3

Ref: 7W-GW6264