CAS 139667-74-6

{3-[(3,4-dichlorobenzyl)amino]propyl}(diethoxymethyl)phosphinic acid

Description:

{3-[(3,4-dichlorobenzyl)amino]propyl}(diethoxymethyl)phosphinic acid, with CAS number 139667-74-6, is a phosphinic acid derivative characterized by its unique structure that includes a phosphinic acid functional group and a substituted amino group. This compound typically exhibits properties associated with phosphinic acids, such as potential applications in agriculture as a herbicide or fungicide due to its ability to interact with biological systems. The presence of the 3,4-dichlorobenzyl moiety suggests enhanced lipophilicity, which may influence its bioavailability and efficacy. Additionally, the diethoxymethyl groups contribute to its stability and solubility in organic solvents. The compound's reactivity can be attributed to the phosphinic acid group, which can participate in various chemical reactions, including nucleophilic substitutions. Overall, this substance is of interest in both synthetic chemistry and potential applications in crop protection, although specific safety and handling guidelines should be followed due to its chemical nature.

Formula: C₁₅H₂₄Cl₂NO₄P

InChI: InChI=1/C15H24Cl2NO4P/c1-3-21-15(22-4-2)23(19,20)9-5-8-18-11-12-6-7-13(16)14(17)10-12/h6-7,10,15,18H,3-5,8-9,11H2,1-2H3,(H,19,20)

SMILES: CCOC(OCC)P(=O)(CCCNCc1ccc(c(c1)Cl)Cl)O

Synonyms:

• Phosphinic acid, P-[3-[[(3,4-dichlorophenyl)methyl]amino]propyl]-P-(diethoxymethyl)-
• {3-[(3,4-Dichlorobenzyl)amino]propyl}(diethoxymethyl)phosphinic acid

Phosphinic acid, P-[3-[[(3,4-dichlorophenyl)methyl]amino]propyl]-P-(diethoxymethyl)-

CAS: 139667-74-6

Formula: C₁₅H₂₄Cl₂NO₄P

Purity: 98%

Color and Shape: Solid

Molecular weight: 384.2351

Ref: IN-DA001BH2

3-([[[(3,4-Dichlorophenyl)Methyl]Amino]Propyl] Diethoxymethyl)Phosphinic Acid

CAS: 139667-74-6

3-([[[(3,4-Dichlorophenyl)Methyl]Amino]Propyl] Diethoxymethyl)Phosphinic Acid

Purity: 99%

Molecular weight: 384.24g/mol

Ref: 54-OR1010619

CGP52432

CAS: 139667-74-6

CGP52432

Purity: ≥98%

Molecular weight: 384.24g/mol

Ref: 54-BUP01768

CGP52432

CAS: 139667-74-6

CGP52432 is a very potent antagonist of GABAB receptors (IC50 = 85 nM).

Formula: C₁₅H₂₄Cl₂NO₄P

Purity: 98.75%

Color and Shape: Solid

Molecular weight: 384.24

Ref: TM-T4363

Phosphinic acid, P-[3-[[(3,4-dichlorophenyl)methyl]amino]propyl]-P-(diethoxymethyl)-

CAS: 139667-74-6

Purity: 98%

Molecular weight: 384.230011

Ref: 10-F861824

CGP 52432

CAS: 139667-74-6

CGP 52432 is a baclofen analog that blocks 2-adrenergic receptors, which are G protein-coupled receptors. CGP 52432 has been shown to inhibit the binding of estradiol benzoate with DNA in vitro and to have pharmacological properties similar to those of nonsteroidal anti-inflammatory drugs. The drug has been shown to be a low potency antagonist of rat 2-adrenergic receptors in vitro and is being studied for its potential as a treatment for neuropathic pain.

Formula: C₁₅H₂₄Cl₂NO₄P

Purity: Min. 95%

Molecular weight: 384.24 g/mol

Ref: 3D-PFA66774