CAS 139669-95-7

2,4-Dibromo-thiazole-5-carbaldehyde

Description:

2,4-Dibromo-thiazole-5-carbaldehyde is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. The compound features two bromine substituents at the 2 and 4 positions of the thiazole ring, contributing to its reactivity and potential applications in various chemical reactions. The aldehyde functional group at the 5-position enhances its electrophilic character, making it useful in synthetic organic chemistry, particularly in the formation of carbon-carbon bonds and as a building block for more complex molecules. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science. Safety precautions should be taken when handling this compound, as brominated compounds can be hazardous, and proper storage conditions should be observed to maintain its stability.

Formula: C₄HBr₂NOS

InChI: InChI=1/C4HBr2NOS/c5-3-2(1-8)9-4(6)7-3/h1H

SMILES: C(=O)c1c(Br)nc(Br)s1

Synonyms:

• 2,4-Dibromo-1,3-Thiazole-5-Carbaldehyde

5-Thiazolecarboxaldehyde, 2,4-dibromo-

CAS: 139669-95-7

Formula: C₄HBr₂NOS

Purity: 97%

Color and Shape: Solid

Molecular weight: 270.9298

Ref: IN-DA001BGZ

2,4-Dibromothiazole-5-carbaldehyde

CAS: 139669-95-7

2,4-Dibromothiazole-5-carbaldehyde

Purity: 97%

Molecular weight: 270.93g/mol

Ref: 54-OR91152

2,4-Dibromothiazole-5-carboxaldehyde

CAS: 139669-95-7

Formula: C₄HBr₂NOS

Purity: 95%

Color and Shape: Solid

Molecular weight: 270.93

Ref: 10-F076102