CAS 1396762-17-6

Pyridine, 3-(bromomethyl)-4-methoxy-, hydrobromide (1:1)

Description:

Pyridine, 3-(bromomethyl)-4-methoxy-, hydrobromide (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromomethyl group at the 3-position and a methoxy group at the 4-position contributes to its reactivity and potential applications in organic synthesis. As a hydrobromide salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various chemical reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Safety data should be consulted, as halogenated compounds can pose health risks, including toxicity and environmental hazards. Overall, this compound serves as a valuable intermediate in the synthesis of more complex organic molecules.

Formula: C₇H₈BrNO·BrH

InChI: InChI=1S/C7H8BrNO.BrH/c1-10-7-2-3-9-5-6(7)4-8;/h2-3,5H,4H2,1H3;1H

InChI key: InChIKey=LRPOLGPXHXEEAB-UHFFFAOYSA-N

SMILES: C(Br)C=1C(OC)=CC=NC1.Br

Synonyms:

• Pyridine, 3-(bromomethyl)-4-methoxy-, hydrobromide (1:1)

3-(Bromomethyl)-4-methoxypyridine hydrobromide

CAS: 1396762-17-6

Formula: C₇H₉Br₂NO

Molecular weight: 282.9605

Ref: IN-DA001BHJ

3-(Bromomethyl)-4-methoxypyridine hydrobromide

CAS: 1396762-17-6

Versatile small molecule scaffold

Formula: C₇H₉Br₂NO

Purity: Min. 95%

Molecular weight: 282.96 g/mol

Ref: 3D-WFC76217