CymitQuimica logo

CAS 1396762-20-1

:

1H-Pyrazole-4-methanamine, α,1-dimethyl-, hydrochloride (1:1)

Description:
1H-Pyrazole-4-methanamine, α,1-dimethyl-, hydrochloride (1:1), with the CAS number 1396762-20-1, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a methanamine group and two methyl groups attached to the alpha position of the pyrazole, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and makes it suitable for various applications, including pharmaceutical research. The presence of the hydrochloride indicates that it can form a stable ionic compound, which may influence its bioavailability and reactivity. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry. However, specific details regarding its toxicity, stability, and reactivity would require further investigation through experimental data and literature.
Formula:C6H11N3·ClH
InChI:InChI=1S/C6H11N3.ClH/c1-5(7)6-3-8-9(2)4-6;/h3-5H,7H2,1-2H3;1H
InChI key:InChIKey=KRCFGJPYGKFYQB-UHFFFAOYSA-N
SMILES:C(C)(N)C1=CN(C)N=C1.Cl
Synonyms:
  • 1H-Pyrazole-4-methanamine, α,1-dimethyl-, hydrochloride (1:1)
Found 3 products.