CAS 1396962-58-5

N-[(4-Chlorophenyl)sulfonyl]threonine

Description:

N-[(4-Chlorophenyl)sulfonyl]threonine is a chemical compound characterized by the presence of a threonine amino acid backbone modified with a sulfonyl group attached to a 4-chlorophenyl moiety. This compound features a sulfonamide functional group, which is known for its potential biological activity, including antimicrobial and anti-inflammatory properties. The 4-chlorophenyl group contributes to the compound's lipophilicity, potentially influencing its interaction with biological targets. The threonine component introduces hydroxyl and amino functionalities, which can participate in hydrogen bonding and enhance solubility in polar solvents. The presence of the chlorine atom on the phenyl ring may also affect the compound's electronic properties and reactivity. Overall, N-[(4-Chlorophenyl)sulfonyl]threonine is of interest in medicinal chemistry and drug development, particularly for its potential therapeutic applications. Its specific characteristics, such as melting point, solubility, and stability, would require empirical determination through experimental methods.

Formula: C₁₀H₁₂ClNO₅S

InChI: InChI=1S/C10H12ClNO5S/c1-6(13)9(10(14)15)12-18(16,17)8-4-2-7(11)3-5-8/h2-6,9,12-13H,1H3,(H,14,15)

InChI key: InChIKey=PQRYZRJKXCNTKT-UHFFFAOYSA-N

SMILES: S(NC(C(C)O)C(O)=O)(=O)(=O)C1=CC=C(Cl)C=C1

Synonyms:

• N-[(4-Chlorophenyl)sulfonyl]threonine
• Threonine, N-[(4-chlorophenyl)sulfonyl]-

2-(4-Chlorobenzenesulfonamido)-3-hydroxybutanoic acid

CAS: 1396962-58-5

Versatile small molecule scaffold

Formula: C₁₀H₁₂ClNO₅S

Purity: Min. 95%

Molecular weight: 293.72 g/mol

Ref: 3D-WFC96258