CAS 1396962-69-8

Alanine, N-[(2-chlorophenyl)methyl]-, hydrochloride (1:1)

Description:

Alanine, N-[(2-chlorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes an alanine backbone modified with a 2-chlorobenzyl group. This modification imparts specific pharmacological properties, making it of interest in medicinal chemistry. The hydrochloride form indicates that the compound is a salt, enhancing its solubility in water and stability, which is crucial for biological applications. The presence of the 2-chlorophenyl group suggests potential interactions with biological targets, possibly influencing its activity as a drug or therapeutic agent. The compound's molecular weight, solubility, and stability under various conditions are essential for its application in research and development. Additionally, safety data and handling precautions are important due to the presence of the chlorinated aromatic moiety, which may pose environmental and health risks. Overall, this compound represents a unique combination of amino acid and aromatic chemistry, with potential implications in pharmaceutical development.

Formula: C₁₀H₁₂ClNO₂·ClH

InChI: InChI=1S/C10H12ClNO2.ClH/c1-7(10(13)14)12-6-8-4-2-3-5-9(8)11;/h2-5,7,12H,6H2,1H3,(H,13,14);1H

InChI key: InChIKey=WCFYWXLAYRHLIE-UHFFFAOYSA-N

SMILES: C(NC(C(O)=O)C)C1=C(Cl)C=CC=C1.Cl

Synonyms:

• Alanine, N-[(2-chlorophenyl)methyl]-, hydrochloride (1:1)

2-{[(2-Chlorophenyl)methyl]amino}propanoic acid hydrochloride

CAS: 1396962-69-8

Versatile small molecule scaffold

Formula: C₁₀H₁₃Cl₂NO₂

Purity: Min. 95%

Molecular weight: 250.12 g/mol

Ref: 3D-WFC96269