CAS 1396965-89-1

Valine, N-(2-pyridinylmethyl)-, hydrochloride (1:2)

Description:

Valine, N-(2-pyridinylmethyl)-, hydrochloride (1:2) is a chemical compound that features a valine amino acid structure modified with a pyridinylmethyl group. This modification enhances its potential for various biological activities, making it of interest in pharmaceutical and biochemical research. The hydrochloride form indicates that the compound is a salt, which typically improves its solubility in water and stability. Valine itself is one of the essential branched-chain amino acids, playing a crucial role in protein synthesis and metabolic processes. The presence of the pyridine ring may contribute to unique interactions with biological targets, potentially influencing its pharmacological properties. As a hydrochloride salt, it is likely to exhibit characteristics such as increased hygroscopicity and altered melting points compared to its free base form. Overall, this compound may be explored for its applications in drug development, particularly in areas related to metabolic disorders or as a building block in peptide synthesis.

Formula: C₁₁H₁₆N₂O₂·2ClH

InChI: InChI=1S/C11H16N2O2.2ClH/c1-8(2)10(11(14)15)13-7-9-5-3-4-6-12-9;;/h3-6,8,10,13H,7H2,1-2H3,(H,14,15);2*1H

InChI key: InChIKey=KMOGTWVIDSEYRW-UHFFFAOYSA-N

SMILES: C(NC(C(C)C)C(O)=O)C1=CC=CC=N1.Cl

Synonyms:

• Valine, N-(2-pyridinylmethyl)-, hydrochloride (1:2)

3-Methyl-2-[(pyridin-2-ylmethyl)amino]butanoic acid dihydrochloride

CAS: 1396965-89-1

Versatile small molecule scaffold

Formula: C₁₁H₁₈Cl₂N₂O₂

Purity: Min. 95%

Molecular weight: 281.18 g/mol

Ref: 3D-WFC96589