CAS 1396967-49-9
:5-(2-Hydroxypropyl)-2-methoxybenzenesulfonamide
Description:
5-(2-Hydroxypropyl)-2-methoxybenzenesulfonamide, identified by its CAS number 1396967-49-9, is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a methoxy group and a hydroxypropyl substituent on a benzene ring, contributing to its solubility and reactivity. The presence of the sulfonamide group suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting bacterial infections or other therapeutic areas. The hydroxypropyl group enhances the compound's hydrophilicity, which may influence its bioavailability and interaction with biological systems. Additionally, the methoxy group can affect the electronic properties of the molecule, potentially modulating its activity. Overall, this compound's unique structural features may provide a basis for further research into its biological activities and potential applications in medicinal chemistry.
Formula:C10H15NO4S
InChI:InChI=1S/C10H15NO4S/c1-7(12)5-8-3-4-9(15-2)10(6-8)16(11,13)14/h3-4,6-7,12H,5H2,1-2H3,(H2,11,13,14)
InChI key:InChIKey=AGRCLHMPIDJPOX-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=C(OC)C=CC(CC(C)O)=C1
Synonyms:- 5-(2-Hydroxypropyl)-2-methoxybenzenesulfonamide
- Benzenesulfonamide, 5-(2-hydroxypropyl)-2-methoxy-
- Tamsulosin Impurity 17
- Tamsulosin Impurity R
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

