CAS 139697-88-4

[2-(2-FURYL)PHENYL]METHANOL

Description:

[2-(2-FURYL)PHENYL]METHANOL, with the CAS number 139697-88-4, is an organic compound characterized by its unique structure, which includes a phenyl group and a furan ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of hydroxyl (-OH) functional group. The furan moiety contributes to its aromatic characteristics, while the phenyl group enhances its hydrophobic nature. It may display moderate solubility in organic solvents and limited solubility in water, depending on the specific conditions. The hydroxyl group can participate in hydrogen bonding, influencing its physical properties and reactivity. This compound may be of interest in various fields, including organic synthesis and materials science, due to its potential applications in pharmaceuticals, agrochemicals, or as a building block for more complex molecules. However, specific reactivity and stability can vary based on environmental conditions and the presence of other functional groups.

Formula: C₁₁H₁₀O₂

InChI: InChI=1/C11H10O2/c12-8-9-4-1-2-5-10(9)11-6-3-7-13-11/h1-7,12H,8H2

SMILES: c1ccc(c(c1)CO)c1ccco1

Synonyms:

• Rarechem Al Bd 1439
• [2-(2-Furyl)phenyl]methanol 97%
• (2-Furan-2-Ylphenyl)Methanol

2-(Fur-2-yl)benzyl alcohol

CAS: 139697-88-4

2-(Fur-2-yl)benzyl alcohol

Formula: C₁₁H₁₀O₂

Purity: 97%

Color and Shape: light yellow to light orange solid

Molecular weight: 174.20g/mol

Ref: 54-OR9307