CAS 139705-74-1
:4-IMIDAZO[1,2-A]PYRIDIN-2-YL-PHENYLAMINE
Description:
4-Imidazo[1,2-a]pyridin-2-yl-phenylamine is a chemical compound characterized by its unique structure, which includes an imidazo[1,2-a]pyridine moiety fused to a phenylamine group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to its nitrogen-containing ring structure. It may display characteristics like moderate solubility in organic solvents and varying stability depending on environmental conditions. The presence of both imidazole and phenylamine functionalities suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the compound may participate in various chemical reactions, including electrophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular environment. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C13H11N3
InChI:InChI=1/C13H11N3/c14-11-6-4-10(5-7-11)12-9-16-8-2-1-3-13(16)15-12/h1-9H,14H2
SMILES:c1ccn2cc(c3ccc(cc3)N)nc2c1
Synonyms:- 4-Imidazo[1,2-A]Pyridin-2-Ylaniline
- Iflab-Bb F1912-0016
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(Imidazo[1,2-a]pyrid-2-yl)aniline, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C13H11N3Purity:95%Color and Shape:Powder, Pale yellowMolecular weight:209.254-Imidazo[1,2-a]pyridin-2-ylaniline
CAS:Formula:C13H11N3Color and Shape:SolidMolecular weight:209.24654-(Imidazo[1,2-a]pyridin-2-yl)aniline
CAS:4-(Imidazo[1,2-a]pyridin-2-yl)anilineFormula:C13H11N3Purity:≥95%Color and Shape: off-white solidMolecular weight:209.24654g/mol4-Imidazo[1,2-a]pyridin-2-ylaniline
CAS:Purity:97.0%Color and Shape:SolidMolecular weight:209.2519989013672



