CAS 139722-91-1
:1-ACETOXY-1,1,3,3,5,5-HEXAMETHYLTRISILOXANE
Description:
1-Acetooxy-1,1,3,3,5,5-hexamethyltrisiloxane, with CAS number 139722-91-1, is a siloxane compound characterized by its unique structure that includes a trisiloxane backbone and acetoxy functional group. This compound typically exhibits properties common to siloxanes, such as low surface tension, thermal stability, and resistance to moisture. It is often used in various applications, including as a silicone-based additive in formulations for personal care products, coatings, and sealants due to its ability to enhance spreadability and improve texture. The presence of the acetoxy group can also impart reactivity, making it useful in cross-linking reactions. Additionally, its hexamethyl substitution contributes to its hydrophobic nature, which can be advantageous in applications requiring water repellency. Overall, 1-acetooxy-1,1,3,3,5,5-hexamethyltrisiloxane is valued for its multifunctional properties, making it a versatile component in both industrial and consumer products.
Formula:C8H22O4Si3
InChI:InChI=1/C8H22O4Si3/c1-8(9)10-14(4,5)12-15(6,7)11-13(2)3/h13H,1-7H3
SMILES:CC(=O)O[Si](C)(C)O[Si](C)(C)O[SiH](C)C
Synonyms:- 1,1,3,3,5,5-Hexamethyltrisiloxanyl acetate
- Trisiloxan-1-ol, 1,1,3,3,5,5-hexamethyl-, acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Acetoxy-1,1,3,3,5,5,-hexamethyltrisiloxane
CAS:S00020 - 1-Acetoxy-1,1,3,3,5,5,-hexamethyltrisiloxane
Formula:C8H22O4Si3Color and Shape:Liquid, ClearMolecular weight:266.515
