
CAS 139742-12-4
:β-D-Glucopyranosiduronic acid, (2β,3β,4α)-28-(β-D-glucopyranosyloxy)-2-hydroxy-23,28-dioxo-30-noroleana-12,20(29)-dien-3-yl 3-O-(6-deoxy-α-L-mannopyranosyl)-
Description:
β-D-Glucopyranosiduronic acid, with the CAS number 139742-12-4, is a complex glycoside characterized by its structural components, which include a glucopyranosyl moiety and a unique aglycone derived from the oleanane triterpenoid framework. This compound features multiple hydroxyl groups, contributing to its solubility in polar solvents and its potential biological activity. The presence of uronic acid indicates that it may participate in various biochemical processes, including cell signaling and structural roles in polysaccharides. Its specific stereochemistry, denoted by the (2β,3β,4α) configuration, suggests that it may exhibit distinct interactions with biological receptors or enzymes. Additionally, the presence of a 6-deoxy-α-L-mannopyranosyl group further enhances its structural complexity and potential functionality. Overall, this compound may have applications in pharmacology or biochemistry, particularly in studies related to plant-derived substances and their derivatives. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C47H70O20
InChI:InChI=1S/C47H70O20/c1-19-9-12-47(42(61)67-40-32(56)30(54)28(52)24(17-48)63-40)14-13-45(5)21(22(47)15-19)7-8-26-43(3)16-23(50)37(44(4,18-49)25(43)10-11-46(26,45)6)66-41-34(58)35(33(57)36(65-41)38(59)60)64-39-31(55)29(53)27(51)20(2)62-39/h7,18,20,22-37,39-41,48,50-58H,1,8-17H2,2-6H3,(H,59,60)
InChI key:InChIKey=LDBTUYKNDDNDJO-UHFFFAOYSA-N
SMILES:C(OC1OC(CO)C(O)C(O)C1O)(=O)C23C(C=4C(C)(CC2)C5(C)C(CC4)C6(C)C(CC5)C(C=O)(C)C(OC7C(O)C(OC8C(O)C(O)C(O)C(C)O8)C(O)C(C(O)=O)O7)C(O)C6)CC(=C)CC3
Synonyms:- Amaranthus saponin IV
- β-D-Glucopyranosiduronic acid, (2β,3β,4α)-28-(β-D-glucopyranosyloxy)-2-hydroxy-23,28-dioxo-30-noroleana-12,20(29)-dien-3-yl 3-O-(6-deoxy-α-L-mannopyranosyl)-
- 30-Noroleanane, β-D-glucopyranosiduronic acid deriv.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Amaranthussaponin IV
CAS:Amaranthussaponin IV is a useful organic compound for research related to life sciences. The catalog number is T125932 and the CAS number is 139742-12-4.Formula:C47H70O20Color and Shape:SolidMolecular weight:955.057
