CymitQuimica logo

CAS 139756-30-2

:

5-(2-ethoxyphenyl)-3-propyl-1,6-dihydro-7H-pyrazolo[4,3-d]pyrimidin-7-one

Description:
5-(2-Ethoxyphenyl)-3-propyl-1,6-dihydro-7H-pyrazolo[4,3-d]pyrimidin-7-one, with the CAS number 139756-30-2, is a chemical compound characterized by its complex heterocyclic structure, which includes a pyrazolo-pyrimidine core. This compound features an ethoxyphenyl group and a propyl substituent, contributing to its unique chemical properties and potential biological activity. The presence of the pyrazolo and pyrimidine rings suggests that it may exhibit interesting pharmacological properties, possibly acting as a bioactive molecule in medicinal chemistry. Its structure may allow for interactions with various biological targets, making it a candidate for further research in drug development. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the rings, which are critical for its application in various chemical and pharmaceutical contexts. Overall, this compound represents a class of heterocyclic compounds that are of significant interest in the fields of organic chemistry and drug discovery.
Formula:C16H18N4O2
InChI:InChI=1/C16H18N4O2/c1-3-7-11-13-14(20-19-11)16(21)18-15(17-13)10-8-5-6-9-12(10)22-4-2/h5-6,8-9H,3-4,7H2,1-2H3,(H,19,20)(H,17,18,21)
SMILES:CCCc1c2c(c(=O)[nH]c(c3ccccc3OCC)n2)n[nH]1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.