CymitQuimica logo

CAS 139756-31-3

:

4-ethoxy-3-(7-oxo-3-propyl-6,7-dihydro-1H-pyrazolo[4,3-d]pyrimidin-5-yl)benzenesulfonyl chloride

Description:
4-Ethoxy-3-(7-oxo-3-propyl-6,7-dihydro-1H-pyrazolo[4,3-d]pyrimidin-5-yl)benzenesulfonyl chloride, with the CAS number 139756-31-3, is a chemical compound characterized by its complex structure, which includes a sulfonyl chloride functional group. This compound features a benzenesulfonyl moiety, which is known for its reactivity and ability to form sulfonamide bonds. The presence of the ethoxy group contributes to its solubility and potential reactivity in organic synthesis. The pyrazolo[4,3-d]pyrimidine core indicates potential biological activity, as many compounds in this class exhibit pharmacological properties. The compound is likely to be a solid at room temperature and may be sensitive to moisture due to the sulfonyl chloride group, which can hydrolyze to form the corresponding sulfonic acid. Its reactivity makes it useful in various chemical reactions, particularly in the synthesis of more complex molecules in medicinal chemistry. Proper handling and storage conditions are essential to maintain its stability and efficacy.
Formula:C16H17ClN4O4S
InChI:InChI=1/C16H17ClN4O4S/c1-3-5-11-13-14(21-20-11)16(22)19-15(18-13)10-8-9(26(17,23)24)6-7-12(10)25-4-2/h6-8H,3-5H2,1-2H3,(H,20,21)(H,18,19,22)
SMILES:CCCc1c2c(c(=O)[nH]c(c3cc(ccc3OCC)S(=O)(=O)Cl)n2)n[nH]1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.