CymitQuimica logo

CAS 1398504-28-3

:

5,7-Difluoro-6-quinolinecarboxylic acid

Description:
5,7-Difluoro-6-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which consists of a fused bicyclic aromatic system. The presence of two fluorine atoms at the 5 and 7 positions of the quinoline ring significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The carboxylic acid functional group at the 6 position contributes to its acidity and reactivity, allowing for various chemical transformations. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its fluorinated nature can enhance metabolic stability and alter the compound's interaction with biological targets. Additionally, 5,7-Difluoro-6-quinolinecarboxylic acid can participate in hydrogen bonding and other intermolecular interactions due to the presence of the carboxylic acid group, which may affect its solubility and reactivity in different solvents. Overall, this compound's unique structural features make it valuable for research and potential applications in drug development and other chemical syntheses.
Formula:C10H5F2NO2
InChI:InChI=1S/C10H5F2NO2/c11-6-4-7-5(2-1-3-13-7)9(12)8(6)10(14)15/h1-4H,(H,14,15)
InChI key:InChIKey=LRIKOJADJPATOK-UHFFFAOYSA-N
SMILES:FC=1C2=C(C=C(F)C1C(O)=O)N=CC=C2
Synonyms:
  • 6-Quinolinecarboxylic acid, 5,7-difluoro-
  • 5,7-Difluoro-6-quinolinecarboxylic acid
Found 4 products.