CAS 139906-05-1: 1-Benzopyrylium, 2-(3,4-dihydroxyphenyl)-5-(beta-D-glucopyranosyloxy)- 7-hydroxy-3-((6-O-((2E)-3-(4-hydroxyphenyl)-1-oxo-2-propenyl)-2-O-beta -D-xylopyranosyl-beta-D-glucopyranosyl)oxy)-, chloride
Description:1-Benzopyrylium, 2-(3,4-dihydroxyphenyl)-5-(beta-D-glucopyranosyloxy)-7-hydroxy-3-((6-O-((2E)-3-(4-hydroxyphenyl)-1-oxo-2-propenyl)-2-O-beta-D-xylopyranosyl-beta-D-glucopyranosyl)oxy)-, chloride, identified by CAS number 139906-05-1, is a complex organic compound characterized by its polyphenolic structure and glycosylation. This substance features a benzopyrylium core, which is a type of heterocyclic compound known for its aromatic properties and potential biological activity. The presence of multiple hydroxyl groups suggests strong hydrogen bonding capabilities, which may enhance its solubility in polar solvents and contribute to its antioxidant properties. The glycosylation with beta-D-glucopyranosyl and beta-D-xylopyranosyl moieties indicates that this compound may exhibit significant biological interactions, potentially influencing its pharmacokinetics and bioavailability. Additionally, the chloride ion suggests that it may exist in a salt form, which can affect its stability and reactivity. Overall, this compound's intricate structure may confer unique chemical properties and potential applications in medicinal chemistry and natural product research.
Formula:C41H45ClO22
InChI:InChI=1/C41H44O22.ClH/c42-13-27-31(50)33(52)36(55)40(61-27)59-25-11-19(44)10-24-20(25)12-26(37(58-24)17-4-7-21(45)22(46)9-17)60-41-38(63-39-35(54)30(49)23(47)14-57-39)34(53)32(51)28(62-41)15-56-29(48)8-3-16-1-5-18(43)6-2-16;/h1-12,23,27-28,30-36,38-42,47,49-55H,13-15H2,(H3-,43,44,45,46,48);1H/t23-,27-,28-,30+,31-,32-,33+,34+,35-,36-,38-,39+,40-,41-;/m1./s1
- Synonyms:
- 2-(3,4-dihydroxyphenyl)-5-(beta-D-glucopyranosyloxy)-7-hydroxychromenium-3-yl 6-O-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]-2-O-beta-D-xylopyranosyl-beta-D-glucopyranoside chloride
- cyanidin 3-(6-(4-coumaroyl)-2-(xylosyl)-glucoside)-5-glucoside
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Cyanidin-3-O-(6''-coumaroyl)-sambubioside 5-O-glucoside chloride REF: 11-0928SCAS: 139906-05-1 | (HPLC) ≥95% | 327.00 € | Tue 08 Apr 25 |

Cyanidin-3-O-(6''-coumaroyl)-sambubioside 5-O-glucoside chloride
Ref: 11-0928S
5mg | 327.00 € |