CAS 13991-36-1
:4-Bromocrotonic Acid
Description:
4-Bromocrotonic acid is an organic compound characterized by its structure, which features a bromine atom attached to a crotonic acid backbone. It is a derivative of crotonic acid, possessing a double bond and a carboxylic acid functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which facilitates its use in laboratory settings. 4-Bromocrotonic acid can be utilized in the synthesis of more complex molecules and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. As with many brominated compounds, it is important to handle it with care due to potential toxicity and environmental concerns associated with bromine-containing substances.
Formula:C4H5BrO2
InChI:InChI=1/C4H5BrO2/c5-3-1-2-4(6)7/h1-2H,3H2,(H,6,7)/b2-1+
Synonyms:- Trans-4-Bromo-2-Butenoic Acid
- (2E)-4-bromobut-2-enoic acid
- Gamma-Bromocrotonic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
(E)-4-Bromocrotonic Acid
CAS:Formula:C4H5BrO2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:164.992-Butenoic acid, 4-bromo-, (2E)-
CAS:Formula:C4H5BrO2Purity:95%Color and Shape:SolidMolecular weight:164.9853γ-Bromocrotonic acid
CAS:γ-Bromocrotonic acidFormula:C4H5BrO2Purity:95%Color and Shape: light beige/brown solidMolecular weight:164.99g/molγ-Bromocrotonic acid
CAS:Formula:C4H5BrO2Purity:90%Color and Shape:Solid, White to very pale reddish yellow powderMolecular weight:164.9864-Bromocrotonic acid - min 98%
CAS:4-Bromocrotonic acid is a 3-mercaptopropionic acid (3-MPA) derivative. It inhibits the enzyme carnitine acyltransferase, which is involved in the uptake of fatty acids into mitochondria and their subsequent β-oxidation. This leads to an accumulation of fatty acids in the cytosol, which can inhibit insulin-stimulated glucose uptake and protein synthesis. 4-Bromocrotonic acid also inhibits glut1, an amp-activated protein kinase enzyme that plays a key role in cellular metabolism, leading to irreversible inhibition. 4-Bromocrotonic acid is used for analytical purposes as it is a good substrate for mitochondrial enzymes.Formula:C4H5BrO2Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:164.99 g/mol








