CymitQuimica logo

CAS 13991-52-1

:

1-Benzyloxy-3-Chloro-2-Propanol

Description:
1-Benzyloxy-3-chloro-2-propanol is an organic compound characterized by its unique functional groups and structure. It features a benzyloxy group, which is a benzene ring attached to an oxygen atom, indicating its potential for aromatic interactions. The presence of a chloro group at the third carbon position contributes to its reactivity, making it a useful intermediate in organic synthesis. This compound is typically a colorless to pale yellow liquid, exhibiting moderate solubility in polar solvents due to the hydroxyl group, which can engage in hydrogen bonding. Its molecular structure suggests it may participate in nucleophilic substitution reactions, particularly due to the electrophilic nature of the chloro substituent. Additionally, the compound may exhibit moderate to low toxicity, necessitating standard safety precautions during handling. Its applications can range from use in pharmaceuticals to serving as a building block in the synthesis of more complex organic molecules. Overall, 1-Benzyloxy-3-chloro-2-propanol is a versatile compound with significant implications in chemical research and industry.
Formula:C10H13ClO2
InChI:InChI=1S/C10H13ClO2/c11-6-10(12)8-13-7-9-4-2-1-3-5-9/h1-5,10,12H,6-8H2
InChI key:FJXVYZMGZACQOS-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)COCC(CCl)O
Found 3 products.