CAS 139926-23-1
:3-ethoxythiophene-2-carboxylic acid
Description:
3-Ethoxythiophene-2-carboxylic acid is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of an ethoxy group (-OCH2CH3) at the 3-position and a carboxylic acid group (-COOH) at the 2-position contributes to its unique chemical properties. This compound is likely to exhibit both acidic behavior due to the carboxylic acid functional group and potential nucleophilicity from the ethoxy group. It may participate in various chemical reactions, including esterification and electrophilic aromatic substitution, owing to the reactivity of the thiophene ring. Additionally, the compound's structure suggests it could be soluble in organic solvents, while the carboxylic acid group may enhance its solubility in polar solvents. Its potential applications could span across organic synthesis, materials science, and possibly in the development of electronic materials, given the conductive properties often associated with thiophene derivatives. Overall, 3-ethoxythiophene-2-carboxylic acid represents a versatile building block in organic chemistry.
Formula:C7H7O3S
InChI:InChI=1/C7H8O3S/c1-2-10-5-3-4-11-6(5)7(8)9/h3-4H,2H2,1H3,(H,8,9)/p-1
SMILES:CCOc1ccsc1C(=O)[O-]
Synonyms:- 3-Ethoxythiophene-2-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Ethoxythiophene-2-carboxylic acid, 97%
CAS:3-Ethoxythiophene-2-carboxylic acid is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code orFormula:C7H7O3SPurity:97%Color and Shape:Crystalline powder, White to cream or pale yellow or greyMolecular weight:171.193-Ethoxythiophene-2-carboxylic acid
CAS:Formula:C7H8O3SColor and Shape:SolidMolecular weight:172.20163-Ethoxythiophene-2-carboxylic acid
CAS:3-Ethoxythiophene-2-carboxylic acidFormula:C7H8O3SPurity:95%Color and Shape: pale brown solidMolecular weight:172.20g/mol3-Ethoxythiophene-2-carboxylic acid
CAS:Versatile small molecule scaffoldFormula:C7H8O3SPurity:Min. 95%Molecular weight:172.2 g/molRef: 3D-PFA92623
Discontinued product



