CAS 139958-16-0: 3-Methoxy-2,6-dimethyl-4-[[2′-(2H-tetrazol-5-yl)[1,1′-biphenyl]-4-yl]methoxy]pyridine

Description:3-Methoxy-2,6-dimethyl-4-[[2′-(2H-tetrazol-5-yl)[1,1′-biphenyl]-4-yl]methoxy]pyridine, with the CAS number 139958-16-0, is a chemical compound characterized by its complex molecular structure, which includes a pyridine ring substituted with methoxy and dimethyl groups, as well as a biphenyl moiety linked through a methoxy group to a tetrazole. This compound is typically studied for its potential pharmacological properties, particularly in the context of medicinal chemistry. The presence of the tetrazole group may contribute to its biological activity, as tetrazoles are known to exhibit various pharmacological effects. The compound's solubility, stability, and reactivity can be influenced by its functional groups, making it of interest in drug development and synthesis. Additionally, its unique structure may allow for specific interactions with biological targets, which is crucial for its potential therapeutic applications. Overall, this compound exemplifies the intricate design often found in modern pharmaceuticals, where structural modifications can lead to enhanced efficacy and selectivity.

Formula:C₂₂H₂₁N₅O₂

InChI:InChI=1S/C22H21N5O2/c1-14-12-20(21(28-3)15(2)23-14)29-13-16-8-10-17(11-9-16)18-6-4-5-7-19(18)22-24-26-27-25-22/h4-12H,13H2,1-3H3,(H,24,25,26,27)

InChI key:InChIKey=FTDRSCZZEUAAIP-UHFFFAOYSA-N

SMILES:N1=NNC(=N1)C=2C=CC=CC2C=3C=CC(=CC3)COC=4C=C(N=C(C4OC)C)C

Synonyms:
ME 3221
Pyridine, 3-methoxy-2,6-dimethyl-4-[[2′-(1H-tetrazol-5-yl)[1,1′-biphenyl]-4-yl]methoxy]-
3-Methoxy-2,6-dimethyl-4-[[2′-(2H-tetrazol-5-yl)[1,1′-biphenyl]-4-yl]methoxy]pyridine
Pyridine, 3-methoxy-2,6-dimethyl-4-[[2′-(2H-tetrazol-5-yl)[1,1′-biphenyl]-4-yl]methoxy]-
3-methoxy-2,6-dimethyl-4-{[2'-(2H-tetrazol-5-yl)biphenyl-4-yl]methoxy}pyridine