CAS 139962-95-1
:4-Methoxy-2-formylphenylboronic acid
Description:
4-Methoxy-2-formylphenylboronic acid is an organic compound characterized by the presence of a boronic acid functional group, a methoxy group, and an aldehyde group attached to a phenyl ring. Its molecular structure features a boron atom bonded to a hydroxyl group and an aryl group, which enhances its reactivity in various chemical reactions, particularly in Suzuki coupling reactions, where it serves as a key building block for synthesizing biaryl compounds. The methoxy group contributes to the compound's electron-donating properties, influencing its reactivity and solubility in organic solvents. The aldehyde functionality allows for further derivatization, making it versatile in organic synthesis. This compound is typically used in medicinal chemistry and materials science due to its ability to form stable complexes with various substrates. Additionally, its boronic acid moiety can participate in reversible covalent bonding with diols, which is significant in the development of sensors and drug delivery systems. Overall, 4-Methoxy-2-formylphenylboronic acid is a valuable compound in synthetic organic chemistry with diverse applications.
Formula:C8H9BO4
InChI:InChI=1/C8H9BO4/c1-13-7-2-3-8(9(11)12)6(4-7)5-10/h2-5,11-12H,1H3
SMILES:COc1ccc(c(c1)C=O)B(O)O
Synonyms:- 2-Formyl-4-methoxyphenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Formyl-4-methoxyphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H9BO4Purity:98.0 to 111.0 %Color and Shape:White to Light yellow powder to crystalMolecular weight:179.97Boronic acid, B-(2-formyl-4-methoxyphenyl)-
CAS:Formula:C8H9BO4Purity:98%Color and Shape:SolidMolecular weight:179.96572-Formyl-4-methoxybenzeneboronic acid
CAS:2-Formyl-4-methoxybenzeneboronic acidFormula:C8H9BO4Purity:97%Color and Shape: off white powderMolecular weight:179.97g/mol4-Methoxy-2-formylphenylboronic acid
CAS:Formula:C8H9BO4Purity:98%Color and Shape:SolidMolecular weight:179.97



