CAS 139962-95-1: 4-Methoxy-2-formylphenylboronic acid

Description:4-Methoxy-2-formylphenylboronic acid is an organic compound characterized by the presence of a boronic acid functional group, a methoxy group, and an aldehyde group attached to a phenyl ring. Its molecular structure features a boron atom bonded to a hydroxyl group and an aryl group, which enhances its reactivity in various chemical reactions, particularly in Suzuki coupling reactions, where it serves as a key building block for synthesizing biaryl compounds. The methoxy group contributes to the compound's electron-donating properties, influencing its reactivity and solubility in organic solvents. The aldehyde functionality allows for further derivatization, making it versatile in organic synthesis. This compound is typically used in medicinal chemistry and materials science due to its ability to form stable complexes with various substrates. Additionally, its boronic acid moiety can participate in reversible covalent bonding with diols, which is significant in the development of sensors and drug delivery systems. Overall, 4-Methoxy-2-formylphenylboronic acid is a valuable compound in synthetic organic chemistry with diverse applications.

Formula:C₈H₉BO₄

InChI:InChI=1/C8H9BO4/c1-13-7-2-3-8(9(11)12)6(4-7)5-10/h2-5,11-12H,1H3

Synonyms:
2-Formyl-4-methoxyphenylboronic acid

Found 5 products.

Product data	Purity	Price range	Estimated delivery
2-Formyl-4-methoxyphenylboronic Acid (contains varying amounts of Anhydride) REF: 3B-F1108CAS: 139962-95-1	98.0 to 111.0 %	73.00 €~227.00 €	Thu 10 Apr 25
4-Methoxy-2-formylphenylboronic acid REF: 10-F011046CAS: 139962-95-1	97.0%	28.00 €~1,019.00 €	Fri 11 Apr 25
Boronic acid, B-(2-formyl-4-methoxyphenyl)- REF: IN-DA001BVBCAS: 139962-95-1	97%	To inquire	Thu 17 Apr 25
2-Formyl-4-methoxybenzeneboronic acid REF: 54-OR7336CAS: 139962-95-1	97%	34.00 €~279.00 €	Mon 21 Apr 25
2-Formyl-4-methoxyphenylboronicacid REF: 3D-FF149404CAS: 139962-95-1	Min. 95%	- - -	Discontinued product