CAS 1399690-75-5

Chaetoglobosin Vb

Description:

Chaetoglobosin Vb is a natural compound classified as a secondary metabolite, primarily derived from certain fungi, particularly those belonging to the genus Chaetomium. This compound is known for its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Chaetoglobosin Vb exhibits notable antifungal and cytotoxic properties, making it of interest in pharmaceutical research, particularly in the development of new antimicrobial agents. Its mechanism of action often involves interference with cellular processes in target organisms, leading to growth inhibition. Additionally, Chaetoglobosin Vb has been studied for its potential applications in cancer therapy due to its ability to induce apoptosis in certain cancer cell lines. The compound is typically characterized by its solubility in organic solvents and its stability under specific conditions, although it may be sensitive to light and heat. Overall, Chaetoglobosin Vb represents a significant area of study in natural product chemistry and its potential therapeutic applications.

Formula: C₃₂H₃₆N₂O₅

InChI: InChI=1S/C32H36N2O5/c1-15-8-7-10-22-28(36)17(3)16(2)27-24(12-19-14-33-23-11-6-5-9-20(19)23)34-31(39)32(22,27)25(35)13-21-26(15)18(4)29(37)30(21)38/h5-7,9-11,14-15,21-22,24,26-28,33,36-37H,8,12-13H2,1-4H3,(H,34,39)/b10-7+/t15-,21+,22-,24-,26-,27-,28+,32+/m0/s1

InChI key: InChIKey=PRTGSLLKDHOTJT-CIQYLYMDSA-N

SMILES: O=C1[C@]23[C@]([C@H](CC=4C=5C(NC4)=CC=CC5)N1)(C(C)=C(C)[C@@H](O)[C@@]2(/C=C/C[C@H](C)[C@@]6([C@@](CC3=O)(C(=O)C(O)=C6C)[H])[H])[H])[H]

Synonyms:

• 1H-Cyclopenta[7,8]cyclodec[1,2-d]isoindole-1,13,15-trione, 2,3,3a,6,6a,9,10,10a,13a,14-decahydro-6,12-dihydroxy-3-(1H-indol-3-ylmethyl)-4,5,10,11-tetramethyl-, (3S,3aR,6S,6aR,7E,10S,10aR,13aR,15aR)-
• (3S,3aR,6S,6aR,7E,10S,10aR,13aR,15aR)-2,3,3a,6,6a,9,10,10a,13a,14-Decahydro-6,12-dihydroxy-3-(1H-indol-3-ylmethyl)-4,5,10,11-tetramethyl-1H-cyclopenta[7,8]cyclodec[1,2-d]isoindole-1,13,15-trione
• 17,21-epi-Chaetoglobosin V
• Chaetoglobosin Vb

chaetoglobosin Vb

CAS: 1399690-75-5

chaetoglobosin Vb

Purity: ≥98%

Ref: 54-BUP22397

chaetoglobosin Vb

CAS: 1399690-75-5

chaetoglobosin Vb is a new cytochalasan alkaloid isolated from endophytic Chaetomium globosum

Formula: C₃₂H₃₆N₂O₅

Purity: 99%

Color and Shape: Solid

Molecular weight: 528.64

Ref: TM-TN6717