CAS 13997-69-8
:N-(4-bromophenyl)prop-2-enamide
Description:
N-(4-bromophenyl)prop-2-enamide is an organic compound characterized by its amide functional group and an alkene structure. It features a prop-2-enamide backbone, which includes a double bond between the second and third carbon atoms, contributing to its reactivity. The presence of the 4-bromophenyl group indicates that a bromine atom is substituted on the phenyl ring at the para position, which can influence the compound's electronic properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its polar amide group. Its chemical properties may include potential reactivity in nucleophilic addition reactions, particularly due to the electrophilic nature of the carbonyl carbon in the amide group. Additionally, the bromine substituent can enhance the compound's ability to participate in electrophilic aromatic substitution reactions. Overall, N-(4-bromophenyl)prop-2-enamide is of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features.
Formula:C9H8BrNO
InChI:InChI=1/C9H8BrNO/c1-2-9(12)11-8-5-3-7(10)4-6-8/h2-6H,1H2,(H,11,12)
SMILES:C=CC(=O)Nc1ccc(cc1)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
