CAS 13997-74-5
:4-bromo-2-(prop-2-en-1-yl)phenol
Description:
4-Bromo-2-(prop-2-en-1-yl)phenol, with the CAS number 13997-74-5, is an organic compound characterized by the presence of a bromine atom and a phenolic hydroxyl group attached to a phenyl ring. The compound features a prop-2-en-1-yl group, which introduces a double bond, contributing to its reactivity and potential applications in organic synthesis. It typically appears as a solid or viscous liquid, depending on the conditions, and is soluble in organic solvents. The presence of the bromine atom enhances its electrophilic character, making it useful in various chemical reactions, including substitution and coupling reactions. Additionally, the phenolic hydroxyl group can participate in hydrogen bonding, influencing its solubility and reactivity. This compound may have applications in the synthesis of pharmaceuticals, agrochemicals, or as an intermediate in organic chemistry. Safety precautions should be observed when handling this substance, as it may pose health risks due to its bromine content and potential reactivity.
Formula:C9H9BrO
InChI:InChI=1/C9H9BrO/c1-2-3-7-6-8(10)4-5-9(7)11/h2,4-6,11H,1,3H2
SMILES:C=CCc1cc(ccc1O)Br
Synonyms:- Phenol, 4-Bromo-2-(2-Propen-1-Yl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Allyl-4-bromophenol
CAS:<p>2-Allyl-4-bromophenol is a reactive phenoxy that scavenges free radicals and reactive oxygen species. It has been shown to be an effective antioxidant in the presence of α-tocopherol and eugenol, which are natural antioxidants. 2-Allyl-4-bromophenol can be used as a synthetic antioxidant for cancer prevention and treatment. Its inhibition mechanism is due to its ability to inhibit the formation of the active monomer form of 4-allyl-2-methoxyphenol by reacting with the enolate ion. This reaction results in a stable product, 2-(2′,4′,5′) trihydroxybenzaldehyde.</p>Formula:C9H9BrOPurity:Min. 95%Color and Shape:PowderMolecular weight:213.07 g/mol
