
CAS 140-60-3
:4-Decylbenzenesulfonic acid
Description:
4-Decylbenzenesulfonic acid is an organic compound characterized by its long hydrophobic alkyl chain and a sulfonic acid functional group. It features a decyl group (a straight-chain alkane with ten carbon atoms) attached to a benzene ring, which is further substituted with a sulfonic acid group (-SO3H) at the para position. This structure imparts both hydrophobic and hydrophilic properties, making it an effective surfactant and emulsifier. The compound is typically a white to light yellow solid at room temperature and is soluble in water, particularly in its ionized form. Its sulfonic acid group contributes to its strong acidity and enhances its ability to interact with various polar and non-polar substances. 4-Decylbenzenesulfonic acid is often used in industrial applications, including detergents, dispersants, and as a reagent in organic synthesis. Additionally, it can serve as a surfactant in various formulations, promoting the stability of emulsions and foams. Safety precautions should be observed when handling this compound, as it may cause irritation to skin and eyes.
Formula:C16H26O3S
InChI:InChI=1S/C16H26O3S/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(14-12-15)20(17,18)19/h11-14H,2-10H2,1H3,(H,17,18,19)
InChI key:InChIKey=UASQKKHYUPBQJR-UHFFFAOYSA-N
SMILES:C(CCCCCCCCC)C1=CC=C(S(=O)(=O)O)C=C1
Synonyms:- p-Decylbenzenesulfonic acid
- Benzenesulfonic acid, p-decyl-
- Benzenesulfonic acid, 4-decyl-
- 4-Decylbenzenesulfonic acid
- p-n-Decylbenzenesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

