
CAS 1400-11-9
:β-D-Glucopyranose, 1,2,6-tris(3-nitropropanoate)
Description:
β-D-Glucopyranose, 1,2,6-tris(3-nitropropanoate) is a derivative of β-D-glucopyranose, a naturally occurring sugar that plays a crucial role in carbohydrate metabolism. This compound features three nitropropanoate ester groups attached to the hydroxyl positions at the 1, 2, and 6 positions of the glucopyranose ring. The presence of these nitropropanoate groups enhances the compound's reactivity and solubility in organic solvents, making it useful in various chemical applications, including as a potential building block in organic synthesis. The nitro groups can also impart unique electronic properties, which may influence the compound's behavior in biological systems. β-D-Glucopyranose itself is known for its role in energy storage and structural functions in living organisms. The specific CAS number 1400-11-9 identifies this compound uniquely in chemical databases, facilitating its study and application in research and industry. Overall, this compound exemplifies the intersection of carbohydrate chemistry and synthetic organic chemistry, with potential implications in pharmaceuticals and materials science.
Formula:C15H21N3O15
InChI:InChI=1S/C15H21N3O15/c19-9(1-4-16(24)25)30-7-8-12(22)13(23)14(32-10(20)2-5-17(26)27)15(31-8)33-11(21)3-6-18(28)29/h8,12-15,22-23H,1-7H2/t8-,12-,13+,14-,15+/m1/s1
InChI key:InChIKey=CNURKUNYCXCBEK-WMNSZERYSA-N
SMILES:O(C(CCN(=O)=O)=O)[C@H]1[C@H](OC(CCN(=O)=O)=O)[C@@H](O)[C@H](O)[C@@H](COC(CCN(=O)=O)=O)O1
Synonyms:- NSC 279515
- Carakin
- Karakin
- β-D-Glucopyranose, 1,2,6-tris(3-nitropropanoate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
