CAS 14000-31-8
:Pyrophosphate
Description:
Pyrophosphate, with the CAS number 14000-31-8, is an inorganic compound characterized by its unique structure, which consists of two phosphate groups linked by an anhydride bond. This compound is often represented by the formula P2O7^4−, indicating its anionic nature. Pyrophosphate is typically found as a salt or ester, and it plays a crucial role in various biochemical processes, particularly in energy transfer and storage, as it is involved in the synthesis and hydrolysis of ATP (adenosine triphosphate). In terms of solubility, pyrophosphate salts are generally soluble in water, making them useful in various applications, including biochemistry and molecular biology. Additionally, pyrophosphate can act as a chelating agent, binding metal ions and influencing enzymatic reactions. Its stability can vary depending on environmental conditions, such as pH and temperature, and it can hydrolyze to form orthophosphate under certain conditions. Overall, pyrophosphate is an important compound in both biological systems and industrial applications.
Formula:O7P2
InChI:InChI=1S/H4O7P2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H2,4,5,6)/p-4
InChI key:InChIKey=XPPKVPWEQAFLFU-UHFFFAOYSA-J
SMILES:O(P(=O)([O-])[O-])P(=O)([O-])[O-]
Synonyms:- Diphosphate
- Pyrophosphate
- Phosphate (P2O74-)
- Pyrophosphate (P2O74-)
- Pyrometaphosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
