CAS 14001-67-3

5-Bromo-2-(Methylthio)Pyrimidine

Description:

5-Bromo-2-(methylthio)pyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a bromine atom and a methylthio group. The presence of the bromine atom introduces notable reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and agrochemicals. The methylthio group enhances the compound's lipophilicity and can influence its biological activity. This compound typically appears as a solid at room temperature and is soluble in organic solvents. Its molecular structure allows for potential interactions with biological targets, which is of interest in drug development. Additionally, the compound may exhibit properties such as antimicrobial or antifungal activity, depending on its specific interactions within biological systems. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 5-Bromo-2-(methylthio)pyrimidine serves as a valuable building block in organic synthesis and pharmaceutical research.

Formula: C₅H₅BrN₂S

InChI: InChI=1/C5H5BrN2S/c1-9-5-7-2-4(6)3-8-5/h2-3H,1H3

SMILES: CSc1ncc(cn1)Br

Synonyms:

• 5-Bromo-2-Methylsulfanylpyrimidine
• 5-Bromo-2-methylthiopyrimidine

Pyrimidine, 5-bromo-2-(methylthio)-

CAS: 14001-67-3

Formula: C₅H₅BrN₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 205.0756

Ref: IN-DA001BXR

5-Bromo-2-(methylthio)pyrimidine

CAS: 14001-67-3

5-Bromo-2-(methylthio)pyrimidine

Formula: C₅H₅BrN₂S

Purity: 98%

Color and Shape: pale yellow solid

Molecular weight: 205.08g/mol

Ref: 54-OR8529

5-Bromo-2-methylthiopyrimidine

CAS: 14001-67-3

Formula: C₅H₅BrN₂S

Purity: 95%

Color and Shape: Liquid, No data available.

Molecular weight: 205.07

Ref: 10-F076456

5-Bromo-2-(methylthio)pyrimidine

CAS: 14001-67-3

5-Bromo-2-(methylthio)pyrimidine is a synthetic compound that has been used to synthesize palladium complexes. It can also be used in the synthesis of vitamin B1, which is an essential nutrient for humans and animals. 5-Bromo-2-(methylthio)pyrimidine binds with magnesium and reacts with sulfoxide, nucleophilic attack and electronegativity. 5-Bromo-2-(methylthio)pyrimidine is activated by 2-chlorobenzothiazole and hydrogen chloride, which leads to nucleophilic attack on the electrophilic carbon atom. This causes a displacement reaction with the elimination of chlorine gas and production of dihydro.

Formula: C₅H₅BrN₂S

Purity: Min. 95%

Molecular weight: 205.08 g/mol

Ref: 3D-FB139356