CAS 14003-16-8
:5-Methyl-2-furanmethanamine
Description:
5-Methyl-2-furanmethanamine, with the CAS number 14003-16-8, is an organic compound characterized by the presence of a furan ring, which is a five-membered aromatic ring containing oxygen. This compound features a methyl group and an amine functional group, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the amine group suggests that it can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, making it useful in the synthesis of pharmaceuticals and agrochemicals. Additionally, the furan moiety can engage in electrophilic aromatic substitution reactions. The compound's solubility in organic solvents and its relatively low boiling point indicate that it may be volatile. Safety data should be consulted for handling, as amines can be irritants and may pose health risks. Overall, 5-Methyl-2-furanmethanamine is a versatile compound with significant potential in chemical research and industry.
Formula:C6H10NO
InChI:InChI=1/C6H9NO/c1-5-2-3-6(4-7)8-5/h2-3H,4,7H2,1H3/p+1
Synonyms:- C-(5-Methyl-Furan-2-Yl)-Methylamine
- 2-Aminomethyl-5-Methylfuran
- 5-Methylfurfurylamine
- Rarechem Al Bw 2332
- 2-Aminomethyl-5-Methyl-Furane
- 2-Aminimethyl-5-methylfuran
- 5-Methyl-2-Furylmethylamine
- 1-(5-Methylfuran-2-Yl)Methanamine
- (5-Methylfuran-2-Yl)Methanaminium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Furanmethanamine, 5-methyl-
CAS:Formula:C6H9NOPurity:98%Color and Shape:LiquidMolecular weight:111.1418(5-Methylfuran-2-yl)methanamine
CAS:(5-Methylfuran-2-yl)methanaminePurity:98%Molecular weight:111.14g/mol5-Methylfurfurylamine
CAS:Formula:C6H9NOPurity:>98.0%(GC)(T)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:111.14(5-Methylfuran-2-yl)methanamine
CAS:Formula:C6H9NOPurity:98%Color and Shape:Liquid, ClearMolecular weight:111.144



