
CAS 14003-17-9
:3,3-Diethyl α3,α3-dicyano-1,2-dihydro-2-oxo-3H-indole-3,3-diacetate
Description:
3,3-Diethyl α3,α3-dicyano-1,2-dihydro-2-oxo-3H-indole-3,3-diacetate, with CAS number 14003-17-9, is a synthetic organic compound characterized by its complex structure, which includes an indole core with multiple functional groups. This compound features two ethyl groups and two cyano groups, contributing to its unique reactivity and potential applications in organic synthesis. The presence of the diacetate moiety suggests that it may participate in various chemical reactions, including esterification and nucleophilic substitutions. Its indole framework is known for its biological activity, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary depending on the solvent and conditions used. As with many synthetic compounds, safety precautions should be taken when handling it, as it may exhibit toxicity or other hazardous properties. Overall, 3,3-Diethyl α3,α3-dicyano-1,2-dihydro-2-oxo-3H-indole-3,3-diacetate represents a versatile structure for further exploration in chemical research and potential applications in pharmaceuticals.
Formula:C18H17N3O5
InChI:InChI=1S/C18H17N3O5/c1-3-25-15(22)12(9-19)18(13(10-20)16(23)26-4-2)11-7-5-6-8-14(11)21-17(18)24/h5-8,12-13H,3-4H2,1-2H3,(H,21,24)
InChI key:InChIKey=XIXQWNIRYBMCLK-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(C#N)C1(C(C(OCC)=O)C#N)C=2C(NC1=O)=CC=CC2
Synonyms:- 3H-Indole-3,3-diacetic acid, α3,α3-dicyano-1,2-dihydro-2-oxo-, 3,3-diethyl ester
- NSC 406112
- 3,3-Diethyl α3,α3-dicyano-1,2-dihydro-2-oxo-3H-indole-3,3-diacetate
- 3,3-Indolinediacetic acid, α,α′-dicyano-2-oxo-, diethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3H-Indole-3,3-diacetic acid, α3,α3-dicyano-1,2-dihydro-2-oxo-, 3,3-diethyl ester
CAS:Formula:C18H17N3O5Molecular weight:355.3447
