CAS 14003-46-4

2-(quinolin-4-yl)acetonitrile

Description:

2-(Quinolin-4-yl)acetonitrile, with the CAS number 14003-46-4, is an organic compound characterized by its quinoline moiety, which contributes to its aromatic properties and potential biological activity. This compound features a nitrile functional group (-C≡N) attached to an acetic acid derivative, making it a versatile building block in organic synthesis. It typically appears as a solid or liquid, depending on the specific conditions, and is known for its moderate solubility in polar organic solvents. The presence of the quinoline ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, the compound may exhibit interesting optical properties and reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if not managed properly. Overall, 2-(quinolin-4-yl)acetonitrile is a compound of interest in both research and industrial applications.

Formula: C₁₁H₈N₂

InChI: InChI=1/C11H8N2/c12-7-5-9-6-8-13-11-4-2-1-3-10(9)11/h1-4,6,8H,5H2

SMILES: c1ccc2c(c1)c(CC#N)ccn2

Synonyms:

• 4-Quinolineacetonitrile
• Quinolin-4-ylacetonitrile

4-Quinolineacetonitrile

CAS: 14003-46-4

Formula: C₁₁H₈N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 168.1946

Ref: IN-DA001BYP

2-(Quinolin-4-yl)acetonitrile

CAS: 14003-46-4

2-(Quinolin-4-yl)acetonitrile

Purity: 98%

Molecular weight: 168.19g/mol

Ref: 54-OR84252

2-(Quinolin-4-yl)acetonitrile

CAS: 14003-46-4

Formula: C₁₁H₈N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 168.199

Ref: 10-F431218

4-Quinolineacetonitrile

Controlled Product

CAS: 14003-46-4

Formula: C₁₁H₈N₂

Color and Shape: Neat

Molecular weight: 168.195

Ref: TR-Q700400