CAS 14005-50-6
:4-Phenyl-2-quinazolinamine
Description:
4-Phenyl-2-quinazolinamine, with the CAS number 14005-50-6, is an organic compound characterized by its quinazoline core structure, which consists of a fused benzene and pyrimidine ring. This compound features a phenyl group attached to the 4-position of the quinazoline ring and an amino group at the 2-position, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the amino group suggests that it can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. 4-Phenyl-2-quinazolinamine has garnered interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting various biological pathways. Its structural features may allow it to interact with specific receptors or enzymes, making it a candidate for further research in pharmacology. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C14H11N3
InChI:InChI=1S/C14H11N3/c15-14-16-12-9-5-4-8-11(12)13(17-14)10-6-2-1-3-7-10/h1-9H,(H2,15,16,17)
InChI key:InChIKey=TXPOSODBCCBORG-UHFFFAOYSA-N
SMILES:NC=1N=C(C2=C(N1)C=CC=C2)C3=CC=CC=C3
Synonyms:- Quinazoline, 2-amino-4-phenyl-
- 2-Amino-4-phenylquinazoline
- 4-Phenyl-2-quinazolinamine
- NSC 107148
- 2-Quinazolinamine, 4-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
