CymitQuimica logo

CAS 14006-82-7

:

ethyl 1,3-dimethyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate

Description:
Ethyl 1,3-dimethyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate, with the CAS number 14006-82-7, is a chemical compound that belongs to the class of indole derivatives. It features a tetrahydroindole structure, which is characterized by a bicyclic system containing both a six-membered and a five-membered ring. The presence of the ethyl ester group contributes to its solubility in organic solvents, making it useful in various chemical applications. The compound exhibits a ketone functional group, indicated by the "4-oxo" designation, which can influence its reactivity and potential applications in organic synthesis. Additionally, the dimethyl groups at the 1 and 3 positions may affect its steric and electronic properties, potentially enhancing its biological activity. Overall, this compound is of interest in medicinal chemistry and may serve as a precursor or intermediate in the synthesis of more complex molecules. Its specific properties, such as melting point, boiling point, and reactivity, would require further investigation through experimental data.
Formula:C13H17NO3
InChI:InChI=1/C13H17NO3/c1-4-17-13(16)12-8(2)11-9(14(12)3)6-5-7-10(11)15/h4-7H2,1-3H3
SMILES:CCOC(=O)c1c(C)c2c(CCCC2=O)n1C
Synonyms:
  • 1H-indole-2-carboxylic acid, 4,5,6,7-tetrahydro-1,3-dimethyl-4-oxo-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.