CymitQuimica logo

CAS 1400637-03-7

:

6-(5-Pyrimidinyl)-3-pyridinecarboxylic acid

Description:
6-(5-Pyrimidinyl)-3-pyridinecarboxylic acid, identified by its CAS number 1400637-03-7, is a heterocyclic organic compound featuring both pyridine and pyrimidine rings. This compound typically exhibits characteristics common to aromatic heterocycles, such as stability and the ability to participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. It is likely to be a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its structural features suggest potential applications in medicinal chemistry, where modifications to the pyridine and pyrimidine rings could enhance its efficacy or selectivity. As with many heterocycles, the electronic properties and steric factors of this compound can significantly influence its reactivity and interactions with biological targets.
Formula:C10H7N3O2
InChI:InChI=1S/C10H7N3O2/c14-10(15)7-1-2-9(13-5-7)8-3-11-6-12-4-8/h1-6H,(H,14,15)
InChI key:InChIKey=TUIKBVKAJTUYKJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(N=C1)C=2C=NC=NC2
Synonyms:
  • 3-Pyridinecarboxylic acid, 6-(5-pyrimidinyl)-
  • 6-(5-Pyrimidinyl)-3-pyridinecarboxylic acid
Found 2 products.