CAS 14007-09-1
:2-(2-methoxyphenoxy)propane-1,3-diol
Description:
2-(2-Methoxyphenoxy)propane-1,3-diol, with the CAS number 14007-09-1, is an organic compound characterized by its structure, which includes a propane backbone with hydroxyl groups at the 1 and 3 positions and a methoxyphenoxy substituent. This compound typically exhibits properties such as solubility in organic solvents and moderate polarity due to the presence of hydroxyl groups, which can engage in hydrogen bonding. The methoxy group contributes to its hydrophobic character, while the phenoxy moiety can enhance its reactivity and potential applications in various chemical reactions. It may be utilized in the synthesis of more complex molecules or as an intermediate in organic synthesis. Additionally, the presence of multiple functional groups suggests potential applications in pharmaceuticals, agrochemicals, or as a surfactant. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H14O4
InChI:InChI=1/C10H14O4/c1-13-9-4-2-3-5-10(9)14-8(6-11)7-12/h2-5,8,11-12H,6-7H2,1H3
SMILES:COc1ccccc1OC(CO)CO
Synonyms:- 1,3-Propanediol, 2-(o-methoxyphenoxy)-
- 2-(o-Methoxyphenoxy)-1,3-propanediol
- Brn 2049374
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Isoguaifenesin
CAS:Ether-alcohols and their halogenated, sulfonated, nitrated or nitrosated derivatives not elsewhere specified or includedFormula:C10H14O4Color and Shape:Off-White PowderMolecular weight:198.089211,3-Propanediol, 2-(2-methoxyphenoxy)-
CAS:Formula:C10H14O4Purity:95%Color and Shape:SolidMolecular weight:198.21582-(2-Methoxyphenoxy)propane-1,3-diol (Guaifenesin Impurity)
CAS:2-(2-Methoxyphenoxy)propane-1,3-diol (Guaifenesin Impurity)Purity:98%Guaifenesin EP Impurity B
CAS:Formula:C10H14O4Color and Shape:White To Off-White SolidMolecular weight:198.222-(2-Methoxyphenoxy)propane-1,3-diol (B-Isomer)
CAS:Controlled ProductFormula:C10H14O4Color and Shape:NeatMolecular weight:198.222-(2-Methoxyphenoxy)-1,3-propanediol
CAS:Impurity Guaifenesin EP Impurity B
Applications 2-(2-Methoxyphenoxy)-1,3-propanediol is a impurity of Guaifenesin (G810502. Guaifenesin Impurity D
References Schieffer, G.W., et al.: J. Pharma. Sci., 72, 1856 (1984);Formula:C10H14O4Color and Shape:WhiteMolecular weight:198.22Guaifenesin EP Impurity B
CAS:Guaifenesin (GP) is a phenylpropanoid that is used as an expectorant and cough suppressant. Guaifenesin EP Impurity B is a by-product of the synthesis of guaifenesin, which can be removed by preparative chromatography. It has been shown to catalyze reactions with acidic substrates and has the ability to form magnesium complexes. The reaction mechanism for guaifenesin EP Impurity B is not well understood, but it has been shown that hydrotalcite and magnesium oxide can remove GP from solution. This impurity also reacts with zirconium to form zirconium oxide, which can be removed by techniques such as mesoporous silica gel chromatography.Formula:C10H14O4Purity:Min. 95%Molecular weight:198.22 g/mol








