CymitQuimica logo

CAS 1400764-40-0

:

2-Piperidinone, 4-(aminomethyl)-, hydrochloride (1:1)

Description:
2-Piperidinone, 4-(aminomethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidinone structure, which features a six-membered ring containing nitrogen and a carbonyl group. The presence of an aminomethyl group at the 4-position enhances its reactivity and potential for forming various derivatives. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for applications in pharmaceuticals and biochemistry. This compound may exhibit basic properties due to the amine group, allowing it to participate in protonation and other acid-base reactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions, given the role of piperidine derivatives in various therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity. Further characterization, including spectral analysis, would provide additional insights into its properties and applications.
Formula:C6H12N2O·ClH
InChI:InChI=1S/C6H12N2O.ClH/c7-4-5-1-2-8-6(9)3-5;/h5H,1-4,7H2,(H,8,9);1H
InChI key:InChIKey=XHSJQWNKJPCKEN-UHFFFAOYSA-N
SMILES:C(N)C1CC(=O)NCC1.Cl
Synonyms:
  • 4-Aminomethylpiperidin-2-one hydrochloride
  • 2-Piperidinone, 4-(aminomethyl)-, hydrochloride (1:1)
Found 4 products.