CymitQuimica logo

CAS 1400764-60-4

:

3-methylsulfonylazetidine,hydrochloride

Description:
3-Methylsulfonylazetidine hydrochloride is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing nitrogen. The presence of a methylsulfonyl group enhances its solubility and reactivity, making it of interest in various chemical applications, including medicinal chemistry. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. The compound may exhibit biological activity, potentially serving as a building block in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests that it could participate in nucleophilic substitution reactions due to the presence of the sulfonyl group, which can influence its reactivity and interactions with biological targets. Safety data and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, 3-methylsulfonylazetidine hydrochloride represents a versatile compound with potential applications in synthetic organic chemistry and drug development.
Formula:C4H10ClNO2S
InChI:InChI=1S/C4H9NO2S.ClH/c1-8(6,7)4-2-5-3-4;/h4-5H,2-3H2,1H3;1H
InChI key:VGUZBHCVRWHGTL-UHFFFAOYSA-N
SMILES:CS(=O)(=O)C1CNC1.Cl
Synonyms:
  • ;3-Methanesulfonylazetidine Hydrochloride
  • 3-(Methylsulfonyl)azetidine hydrochloride
  • 3-(Methylsulfonyl)Azetidine Hcl
Found 4 products.