CAS 1400764-62-6

Carbamic acid, N-2-azaspiro[3.3]hept-6-yl-, 1,1-dimethylethyl ester, ethanedioate (1:1)

Description:

Carbamic acid, N-2-azaspiro[3.3]hept-6-yl-, 1,1-dimethylethyl ester, ethanedioate (1:1), identified by CAS number 1400764-62-6, is a chemical compound characterized by its unique structural features, including a spirocyclic framework and carbamate functional group. This compound typically exhibits properties associated with carbamates, such as potential biological activity and reactivity due to the presence of the carbamic acid moiety. The spirocyclic structure may contribute to its conformational rigidity, influencing its interactions with biological targets. The ester functionality suggests that it may undergo hydrolysis under certain conditions, releasing the corresponding acid and alcohol. Additionally, the presence of the ethanedioate component indicates potential for chelation or interaction with metal ions. Overall, this compound may have applications in medicinal chemistry or agrochemicals, although specific biological activities and applications would require further investigation through empirical studies. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₁H₂₀N₂O₂·C₂H₂O₄

InChI: InChI=1S/C11H20N2O2.C2H2O4/c1-10(2,3)15-9(14)13-8-4-11(5-8)6-12-7-11;3-1(4)2(5)6/h8,12H,4-7H2,1-3H3,(H,13,14);(H,3,4)(H,5,6)

InChI key: InChIKey=NUEDJSDOGUZUCX-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1CC2(C1)CNC2.C(C(O)=O)(O)=O

Synonyms:

• Carbamic acid, N-2-azaspiro[3.3]hept-6-yl-, 1,1-dimethylethyl ester, ethanedioate (1:1)

tert-Butyl 2-azaspiro[3.3]hept-6-ylcarbamate oxalate

CAS: 1400764-62-6

tert-Butyl 2-azaspiro[3.3]hept-6-ylcarbamate oxalate

Purity: ≥95%

Ref: 54-OR317080