CAS 1401065-66-4

4-Chloro-2-cyclopropylphenol

Description:

4-Chloro-2-cyclopropylphenol is an organic compound characterized by its phenolic structure, which includes a chlorine atom and a cyclopropyl group attached to the aromatic ring. The presence of the chlorine atom at the para position relative to the hydroxyl group contributes to its reactivity and potential applications in various chemical processes. The cyclopropyl group, a three-membered carbon ring, introduces unique steric and electronic properties that can influence the compound's behavior in biological and chemical systems. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its phenolic nature suggests potential antioxidant properties, and it may also serve as an intermediate in the synthesis of other chemical entities. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks. Overall, 4-Chloro-2-cyclopropylphenol is of interest in both synthetic organic chemistry and potential pharmaceutical applications.

Formula: C₉H₉ClO

InChI: InChI=1S/C9H9ClO/c10-7-3-4-9(11)8(5-7)6-1-2-6/h3-6,11H,1-2H2

InChI key: InChIKey=PQWPXQNBBFTKMB-UHFFFAOYSA-N

SMILES: OC1=C(C=C(Cl)C=C1)C2CC2

4-Chloro-2-cyclopropylphenol

CAS: 1401065-66-4

Versatile small molecule scaffold

Formula: C₉H₉ClO

Purity: Min. 95%

Molecular weight: 168.62 g/mol

Ref: 3D-BGC06566