CAS 1401222-65-8

B-[4-(1,3-Dioxolan-2-yl)phenyl]boronic acid

Description:

B-[4-(1,3-Dioxolan-2-yl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a 1,3-dioxolane moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications including organic synthesis and medicinal chemistry. The dioxolane ring contributes to its solubility and stability in polar solvents, while the boronic acid group allows for participation in Suzuki coupling reactions, a key method for forming carbon-carbon bonds. Additionally, the compound may exhibit unique reactivity due to the presence of the dioxolane, which can influence its interaction with biological targets or other chemical species. Overall, B-[4-(1,3-Dioxolan-2-yl)phenyl]boronic acid is a versatile compound with potential applications in drug development and materials science.

Formula: C₉H₁₁BO₄

InChI: InChI=1S/C9H11BO4/c11-10(12)8-3-1-7(2-4-8)9-13-5-6-14-9/h1-4,9,11-12H,5-6H2

InChI key: InChIKey=MMXMNBDFQFTNRT-UHFFFAOYSA-N

SMILES: B(O)(O)C1=CC=C(C=C1)C2OCCO2

Synonyms:

• B-[4-(1,3-Dioxolan-2-yl)phenyl]boronic acid
• Boronic acid, B-[4-(1,3-dioxolan-2-yl)phenyl]-
• [4-(1,3-Dioxolan-2-yl)phenyl]boronic acid

4-(1,3-Dioxolan-2-yl)phenylboronic Acid

CAS: 1401222-65-8

Formula: C₉H₁₁BO₄

Purity: 95%

Molecular weight: 193.9922

Ref: IN-DA00J7QR

4-(1,3-Dioxolan-2-yl)benzeneboronic acid

CAS: 1401222-65-8

4-(1,3-Dioxolan-2-yl)benzeneboronic acid

Purity: ≥95%

Molecular weight: 193.99g/mol

Ref: 54-OR471586