CAS 1401242-86-1

N,N′-[2,7-Naphthalenediylbis(1H-1,2,3-triazole-4,1-diyl-3,1-phenylene)]bis[2-(diethylamino)acetamide]

Description:

N,N′-[2,7-Naphthalenediylbis(1H-1,2,3-triazole-4,1-diyl-3,1-phenylene)]bis[2-(diethylamino)acetamide] is a complex organic compound characterized by its unique structural features, which include a naphthalene core linked to multiple triazole and phenylene units. This compound exhibits significant potential in various applications, particularly in the fields of medicinal chemistry and materials science, due to its ability to form hydrogen bonds and engage in π-π stacking interactions. The presence of diethylamino groups enhances its solubility in organic solvents and may contribute to its biological activity. Additionally, the triazole moieties can impart stability and facilitate coordination with metal ions, making it a candidate for use in coordination chemistry. Its intricate structure suggests potential for diverse functionalities, including fluorescence and catalytic properties. As with many synthetic compounds, the specific reactivity and interactions of this substance would depend on its environment and the presence of other chemical species. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₃₈H₄₂N₁₀O₂

InChI: InChI=1S/C38H42N10O2/c1-5-45(6-2)25-37(49)39-31-11-9-13-33(21-31)47-23-35(41-43-47)28-17-15-27-16-18-29(20-30(27)19-28)36-24-48(44-42-36)34-14-10-12-32(22-34)40-38(50)26-46(7-3)8-4/h9-24H,5-8,25-26H2,1-4H3,(H,39,49)(H,40,50)

InChI key: InChIKey=WXTDHADVBWQHLW-UHFFFAOYSA-N

SMILES: N(C(CN(CC)CC)=O)C=1C=C(N2C=C(C3=CC4=C(C=CC(=C4)C5=CN(N=N5)C6=CC(NC(CN(CC)CC)=O)=CC=C6)C=C3)N=N2)C=CC1

Synonyms:

• N,N′-[2,7-Naphthalenediylbis(1H-1,2,3-triazole-4,1-diyl-3,1-phenylene)]bis[2-(diethylamino)acetamide]
• CL 67
• Acetamide, N,N′-[2,7-naphthalenediylbis(1H-1,2,3-triazole-4,1-diyl-3,1-phenylene)]bis[2-(diethylamino)-

CL67

CAS: 1401242-86-1

CL67 is a hypoxia-inducible factor pathway inhibitor. It acts by binding to a G-quadruplex higher-order structure in the HIF promoter sequence in vitro.

Formula: C₃₈H₄₂N₁₀O₂

Color and Shape: Solid

Molecular weight: 670.81

Ref: TM-T25255