CAS 140147-36-0
:n-Octyl 3,6-Di-O-(a-D-mannopyranosyl)-b-D-mannopyranoside
Description:
n-Octyl 3,6-Di-O-(α-D-mannopyranosyl)-β-D-mannopyranoside is a glycoside compound characterized by its structure, which includes a long hydrophobic n-octyl chain and two sugar moieties derived from mannose. This compound features both α- and β-anomeric configurations, contributing to its unique solubility and interaction properties. The presence of the octyl group imparts hydrophobic characteristics, making it amphiphilic, which can influence its behavior in biological systems and applications in drug delivery or as a surfactant. The mannopyranosyl units can participate in hydrogen bonding and other interactions, enhancing its potential for forming complexes with proteins or other biomolecules. This compound is of interest in various fields, including biochemistry and materials science, due to its potential applications in creating glycosylated surfaces or as a model for studying carbohydrate-protein interactions. Its specific properties, such as solubility, stability, and reactivity, can vary based on environmental conditions and the presence of other substances.
Formula:C26H48O16
InChI:InChI=1/C26H48O16/c1-2-3-4-5-6-7-8-37-25-22(36)23(42-26-21(35)19(33)16(30)13(10-28)40-26)17(31)14(41-25)11-38-24-20(34)18(32)15(29)12(9-27)39-24/h12-36H,2-11H2,1H3
SMILES:CCCCCCCCOC1C(C(C(C(COC2C(C(C(C(CO)O2)O)O)O)O1)O)OC1C(C(C(C(CO)O1)O)O)O)O
Synonyms:- Octyl3,6-di-O-(a-D-mannopyranosyl)-b-D-mannopyranoside
- octyl 3,6-di-O-(mannopyranosyl)-mannopyranoside
- Man1-a-6[Man1-a-3]Man--O-Octyl
- n-Octyl 3,6-Di-O-(a-D-mannopyranosyl)--D-mannopyranoside
- octyl alpha-D-mannopyranosyl-(1->3)-[alpha-D-mannopyranosyl-(1->6)]-beta-D-mannopyranoside
- Octyl Hexopyranosyl-(1->3)-[Hexopyranosyl-(1->6)]Hexopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Octyl 3,6-di-O-(a-D-mannopyranosyl)-b-D-mannopyranoside
CAS:Octyl 3,6-di-O-(a-D-mannopyranosyl)-b-D-mannopyranoside is an anti-infective agent that belongs to the functional group of mannosides. It is used as a model system for investigating the inhibitory effects of chemical structures on enzymatic activity. Octyl 3,6-di-O-(a-D-mannopyranosyl)-b-D-mannopyranoside has been shown to have inhibitory effects on alzheimer's disease and other neurodegenerative diseases. The octyl 3,6 di O-(a D mannopyranosyl) b D mannopyranoside molecule can be broken down into two parts: octyl 3,6 di O-(a D mannopyranosyl) b D mannose and octyl 6 b D manno pyranose. The octyl 6 b D manno pyrFormula:C26H48O16Purity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:616.65 g/mol

