CAS 140147-38-2
:Octyl β-D-mannopyranoside
Description:
Octyl β-D-mannopyranoside is a non-ionic surfactant and a glycoside derived from mannose, a simple sugar. It features an octyl group, which is an eight-carbon alkyl chain, attached to the anomeric carbon of the mannopyranose ring. This structure imparts amphiphilic properties, allowing it to interact with both hydrophilic and hydrophobic environments, making it useful in various applications, including as a detergent, emulsifier, and stabilizer in biochemical and pharmaceutical formulations. Octyl β-D-mannopyranoside is known for its ability to solubilize membrane proteins and facilitate the extraction of biomolecules, which is particularly valuable in research and industrial processes. It is typically characterized by its low toxicity and biodegradability, making it an environmentally friendly option compared to other surfactants. Additionally, it is soluble in water and organic solvents, enhancing its versatility in different formulations. Its applications extend to cell culture, drug delivery systems, and as a tool in molecular biology for studying protein interactions and membrane dynamics.
Formula:C14H28O6
InChI:InChI=1S/C14H28O6/c1-2-3-4-5-6-7-8-19-14-13(18)12(17)11(16)10(9-15)20-14/h10-18H,2-9H2,1H3/t10-,11-,12+,13+,14-/m1/s1
InChI key:InChIKey=HEGSGKPQLMEBJL-PEBLQZBPSA-N
SMILES:O(CCCCCCCC)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O
Synonyms:- 1-O-Octyl-β-D-mannopyranoside
- Octyl β-D-mannopyranoside
- β-D-Mannopyranoside, octyl
- Octylb-D-mannopyranoside USP/EP/BP
- Octyl beta-D-mannopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Octyl beta-D-Mannopyranoside
CAS:Controlled ProductApplications Octyl β-D-Mannopyranoside (cas# 140147-38-2) is a compound useful in organic synthesis.
Formula:C14H28O6Color and Shape:NeatMolecular weight:292.37Octyl b-D-mannopyranoside
CAS:Octyl b-D-mannopyranoside is a sugar that belongs to the group of complex carbohydrates. It is used in chemical synthesis and is commonly used for click modification, fluorination, glycosylation, carbamoylation, methylation, and other modifications. Octyl b-D-mannopyranoside is a white or off-white powder that can be dissolved in water or alcohols. It has a molecular weight of 536.88 g/mol.
Formula:C14H28O6Purity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:292.37 g/mol


