
CAS 140147-66-6
:β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-α-L-arabinopyranosyl-(1→2)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[(2E)-3-(4-hydroxy-3-methoxyphenyl)-2-propenoate]
Description:
The chemical substance known as β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-α-L-arabinopyranosyl-(1→2)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[(2E)-3-(4-hydroxy-3-methoxyphenyl)-2-propenoate] is a complex glycoside with multiple sugar moieties and phenolic components. It features a glucopyranoside backbone, which is a six-membered cyclic form of glucose, and is substituted with an arabinopyranosyl unit and a 6-deoxy-mannopyranosyl unit, indicating its structural complexity and potential for various biological interactions. The presence of phenolic groups suggests antioxidant properties, while the specific glycosidic linkages may influence its solubility and reactivity. This compound is likely to exhibit significant biological activity, possibly including anti-inflammatory or antimicrobial effects, due to its diverse functional groups. Its CAS number, 140147-66-6, allows for precise identification in chemical databases, facilitating research and application in fields such as pharmacology and biochemistry. Overall, this substance represents a fascinating example of natural product chemistry with potential therapeutic implications.
Formula:C35H46O19
InChI:InChI=1S/C35H46O19/c1-15-25(42)27(44)32(54-33-28(45)26(43)21(40)14-49-33)35(50-15)53-31-29(46)34(48-10-9-17-3-6-18(37)20(39)11-17)51-23(13-36)30(31)52-24(41)8-5-16-4-7-19(38)22(12-16)47-2/h3-8,11-12,15,21,23,25-40,42-46H,9-10,13-14H2,1-2H3/b8-5+/t15-,21-,23+,25-,26-,27+,28+,29+,30+,31+,32+,33-,34+,35-/m0/s1
InChI key:InChIKey=ZPJGTPAAEPXBQT-KMKHSNLESA-N
SMILES:O([C@H]1[C@H](OC(/C=C/C2=CC(OC)=C(O)C=C2)=O)[C@@H](CO)O[C@@H](OCCC3=CC(O)=C(O)C=C3)[C@@H]1O)[C@H]4[C@H](O[C@H]5[C@H](O)[C@@H](O)[C@@H](O)CO5)[C@H](O)[C@@H](O)[C@H](C)O4
Synonyms:- β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-α-L-arabinopyranosyl-(1→2)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[3-(4-hydroxy-3-methoxyphenyl)-2-propenoate], (E)-
- Leonoside A
- Stachysoside C
- β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-α-L-arabinopyranosyl-(1→2)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[(2E)-3-(4-hydroxy-3-methoxyphenyl)-2-propenoate]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Leonoside A
CAS:Leonoside A is a new phenylpropanoid glycoside from Leonurus glaucescens.Formula:C35H46O19Color and Shape:SolidMolecular weight:770.73
