CAS 14015-63-5

1-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]thiourea

Description:

1-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]thiourea, with the CAS number 14015-63-5, is a chemical compound that features a thiazole ring and a thiourea functional group. This substance is characterized by its unique structural components, which include a nitrophenyl group that contributes to its potential reactivity and biological activity. The presence of the thiazole moiety often imparts interesting properties, such as the ability to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the nitro group can influence the compound's electronic properties, making it a candidate for applications in pharmaceuticals or agrochemicals. The thiourea group is known for its ability to form hydrogen bonds and can enhance solubility in polar solvents. Overall, this compound may exhibit diverse biological activities, including antimicrobial or anticancer properties, making it a subject of interest in medicinal chemistry and material science. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with nitro compounds.

Formula: C₁₀H₈N₄O₂S₂

InChI: InChI=1/C10H8N4O2S2/c11-9(17)13-10-12-8(5-18-10)6-1-3-7(4-2-6)14(15)16/h1-5H,(H3,11,12,13,17)

SMILES: c1cc(ccc1c1csc(n1)NC(=N)S)N(=O)=O

Synonyms:

• 2-Thioureido-4-(p-nitrophenyl)thiazole

1-[4-(4-Nitrophenyl)thiazol-2-yl]thiourea

CAS: 14015-63-5

1-[4-(4-Nitrophenyl)thiazol-2-yl]thiourea

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 280.33g/mol

Ref: 54-OR10219

amino((4-(4-nitrophenyl)(2,5-thiazolyl))amino)methane-1-thione

CAS: 14015-63-5

Please enquire for more information about amino((4-(4-nitrophenyl)(2,5-thiazolyl))amino)methane-1-thione including the price, delivery time and more detailed product information at the technical inquiry form on this page

Purity: Min. 95%

Molecular weight: 280.33 g/mol

Ref: 3D-PAA01563