CAS 14018-90-7
:Carbonic acid, compd. with N-phenylguanidine (1:?)
Description:
Carbonic acid, compd. with N-phenylguanidine (1:?) is a chemical compound characterized by its formation from the reaction between carbonic acid and N-phenylguanidine. This compound typically exhibits properties associated with both its acidic and guanidine components. Carbonic acid is a weak acid formed in solution when carbon dioxide dissolves in water, while N-phenylguanidine is an organic compound known for its role in various chemical reactions, particularly in the synthesis of other organic compounds. The interaction between these two components can lead to unique properties, such as altered solubility and reactivity compared to the individual substances. The compound may be utilized in various applications, including pharmaceuticals and materials science, due to its potential to act as a buffering agent or in catalytic processes. However, specific characteristics such as melting point, boiling point, and solubility would depend on the precise formulation and conditions under which the compound is studied. Safety data should also be consulted, as with any chemical substance, to ensure proper handling and usage.
Formula:C7H9N3·xCH2O3
InChI:InChI=1S/C7H9N3.CH2O3/c8-7(9)10-6-4-2-1-3-5-6;2-1(3)4/h1-5H,(H4,8,9,10);(H2,2,3,4)
InChI key:InChIKey=XDSYAIICRRZSJX-UHFFFAOYSA-N
SMILES:N(C(=N)N)C1=CC=CC=C1.C(=O)(O)O
Synonyms:- Carbonic Acid - 1-Phenylguanidine (1:1)
- Carbonic acid, compd. with N-phenylguanidine (1:?)
- Carbonic acid, compd. with phenylguanidine
- Guanidine,Phenyl Carbonate
- Phenylguanidine Carbonate
- Phenylguanidine Carbonate (2:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Phenylguanidine carbonate
CAS:Formula:C8H11N3O3Purity:98%Color and Shape:SolidMolecular weight:197.1912Phenylguanidine Carbonate Salt
CAS:Phenylguanidine Carbonate SaltPurity:98%Molecular weight:197.19g/molPhenylguanidine carbonate
CAS:Phenylguanidine carbonate is a synthetic drug that is used to treat opportunistic infections. It binds to the chloride receptor and prevents the accumulation of sodium ions in cells, thereby inhibiting cell division. Phenylguanidine carbonate has been shown to be effective against wastewater-associated opportunistic pathogens such as Mycobacterium avium complex and Legionella pneumophila. This drug has also been shown to be active against some strains of Chlamydia trachomatis and other bacteria that cause autoimmune diseases such as lupus erythematosus.Formula:C7H9N3•(CH2O3)xPurity:Min. 95%Color and Shape:PowderMolecular weight:197.19 g/molPhenylguanidine Carbonate Salt
CAS:Formula:C7H9N3·X(CH2O3)Color and Shape:Off-WhiteMolecular weight:197.19




