CymitQuimica logo

CAS 1402149-98-7

:

Ethyl 2-((3aR,4S,6R,6aS)-6-amino-2,2-dimethyltetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yloxy)acetate oxalic acid salt

Description:
Ethyl 2-((3aR,4S,6R,6aS)-6-amino-2,2-dimethyltetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yloxy)acetate oxalic acid salt is a complex organic compound characterized by its unique structural features, including a cyclopentadioxole moiety and an amino group. This compound is likely to exhibit properties typical of both esters and amino compounds, such as solubility in polar solvents and potential biological activity due to the presence of the amino group. The oxalic acid salt form suggests enhanced solubility and stability, which can be advantageous for pharmaceutical applications. The stereochemistry indicated by the specific R and S configurations implies that the compound may exhibit chiral properties, potentially influencing its interaction with biological systems. Additionally, the presence of the ethyl ester group may contribute to its lipophilicity, affecting its absorption and distribution in biological contexts. Overall, this compound's intricate structure and functional groups suggest it may have significant relevance in medicinal chemistry or related fields.
Formula:C14H23NO9
InChI:InChI=1S/C12H21NO5.C2H2O4/c1-4-15-9(14)6-16-8-5-7(13)10-11(8)18-12(2,3)17-10;3-1(4)2(5)6/h7-8,10-11H,4-6,13H2,1-3H3;(H,3,4)(H,5,6)/t7-,8+,10+,11-;/m1./s1
InChI key:CPUUHMGQFFBUMG-GGTINJKKSA-N
SMILES:CCOC(=O)CO[C@H]1C[C@H]([C@H]2[C@@H]1OC(O2)(C)C)N.C(=O)(C(=O)O)O
Found 5 products.